C10H17NO3 — CID 85320895
methyl 7-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizine-8-carboxylate (PubChem CID 85320895) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is methyl 7-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizine-8-carboxylate.
| Compound Name | methyl 7-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizine-8-carboxylate |
|---|---|
| PubChem CID | 85320895 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | methyl 7-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizine-8-carboxylate |
| SMILES | COC(=O)C1C(O)CCN2CCCC12 |
| InChI | InChI=1S/C10H17NO3/c1-14-10(13)9-7-3-2-5-11(7)6-4-8(9)12/h7-9,12H,2-6H2,1H3 |
| InChIKey | TZPVVPMQQCEVRQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |