C24H28O8 — CID 85323413
ethyl 7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate (PubChem CID 85323413) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is ethyl 7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate.
| Compound Name | ethyl 7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate |
|---|---|
| PubChem CID | 85323413 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | ethyl 7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate |
| SMILES | CCOC(=O)C1C(CO)Cc2cc3c(cc2C1c1cc(OC)c(OC)c(OC)c1)OCO3 |
| InChI | InChI=1S/C24H28O8/c1-5-30-24(26)22-15(11-25)6-13-7-17-18(32-12-31-17)10-16(13)21(22)14-8-19(27-2)23(29-4)20(9-14)28-3/h7-10,15,21-22,25H,5-6,11-12H2,1-4H3 |
| InChIKey | SQYPMSKDGBNYRU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |