About (octan-2-ylideneamino) acetate
(octan-2-ylideneamino) acetate (PubChem CID 85325162) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (octan-2-ylideneamino) acetate.
Molecular Properties
| Compound Name | (octan-2-ylideneamino) acetate |
| PubChem CID | 85325162 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (octan-2-ylideneamino) acetate |
| SMILES | CCCCCCC(C)=NOC(C)=O |
| InChI | InChI=1S/C10H19NO2/c1-4-5-6-7-8-9(2)11-13-10(3)12/h4-8H2,1-3H3 |
| InChIKey | HPAXTRZPIRVMBM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (octan-2-ylideneamino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (octan-2-ylideneamino) acetate?
The IUPAC name of (octan-2-ylideneamino) acetate (CID 85325162) is (octan-2-ylideneamino) acetate.
What is the SMILES notation for (octan-2-ylideneamino) acetate?
The canonical SMILES for (octan-2-ylideneamino) acetate is CCCCCCC(C)=NOC(C)=O.
What is the InChIKey of (octan-2-ylideneamino) acetate?
The InChIKey is HPAXTRZPIRVMBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-4-5-6-7-8-9(2)11-13-10(3)12/h4-8H2,1-3H3.
What are the key properties of (octan-2-ylideneamino) acetate?
(octan-2-ylideneamino) acetate has a molecular weight of 185.27 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (octan-2-ylideneamino) acetate is sourced from PubChem (CID 85325162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).