C27H36FNO6S — CID 85327072
16-fluoro-7,11-dihydroxy-8,8,10,12-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 85327072) has the molecular formula C27H36FNO6S and a molecular weight of 521.65 g/mol. Its IUPAC name is 16-fluoro-7,11-dihydroxy-8,8,10,12-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 16-fluoro-7,11-dihydroxy-8,8,10,12-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 85327072 |
| Molecular Formula | C27H36FNO6S |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 16-fluoro-7,11-dihydroxy-8,8,10,12-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc2cc(C3CC4OC4(F)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O3)ccc2s1 |
| InChI | InChI=1S/C27H36FNO6S/c1-14-7-6-10-27(28)22(35-27)12-19(17-8-9-20-18(11-17)29-16(3)36-20)34-23(31)13-21(30)26(4,5)25(33)15(2)24(14)32/h8-9,11,14-15,19,21-22,24,30,32H,6-7,10,12-13H2,1-5H3 |
| InChIKey | AEBRZVKUWGUCOD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|