C23H29N3O5 — CID 8532806
(3R)-1-N-phenyl-3-N-[(2,4,5-trimethoxyphenyl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 8532806) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is (3R)-1-N-phenyl-3-N-[(2,4,5-trimethoxyphenyl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-phenyl-3-N-[(2,4,5-trimethoxyphenyl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 8532806 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (3R)-1-N-phenyl-3-N-[(2,4,5-trimethoxyphenyl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)[C@@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C23H29N3O5/c1-29-19-13-21(31-3)20(30-2)12-17(19)14-24-22(27)16-8-7-11-26(15-16)23(28)25-18-9-5-4-6-10-18/h4-6,9-10,12-13,16H,7-8,11,14-15H2,1-3H3,(H,24,27)(H,25,28)/t16-/m1/s1 |
| InChIKey | CAUJTZVCNRVDMI-MRXNPFEDSA-N |
| XLogP | 3.27 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |