C17H23N3O6 — CID 8532970
ethyl (3S)-1-[2-(2-methoxy-5-nitroanilino)-2-oxoethyl]piperidine-3-carboxylate (PubChem CID 8532970) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl (3S)-1-[2-(2-methoxy-5-nitroanilino)-2-oxoethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-(2-methoxy-5-nitroanilino)-2-oxoethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 8532970 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | ethyl (3S)-1-[2-(2-methoxy-5-nitroanilino)-2-oxoethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(CC(=O)Nc2cc([N+](=O)[O-])ccc2OC)C1 |
| InChI | InChI=1S/C17H23N3O6/c1-3-26-17(22)12-5-4-8-19(10-12)11-16(21)18-14-9-13(20(23)24)6-7-15(14)25-2/h6-7,9,12H,3-5,8,10-11H2,1-2H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | GDRZLLBXGCQTPV-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|