C29H23F3N2O4S — CID 85330283
5-[[3-(1-benzyl-3,3,5-trimethyl-2-oxoindol-6-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 85330283) has the molecular formula C29H23F3N2O4S and a molecular weight of 552.57 g/mol. Its IUPAC name is 5-[[3-(1-benzyl-3,3,5-trimethyl-2-oxoindol-6-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-(1-benzyl-3,3,5-trimethyl-2-oxoindol-6-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 85330283 |
| Molecular Formula | C29H23F3N2O4S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 5-[[3-(1-benzyl-3,3,5-trimethyl-2-oxoindol-6-yl)-4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc2c(cc1-c1cc(C=C3SC(=O)NC3=O)ccc1OC(F)(F)F)N(Cc1ccccc1)C(=O)C2(C)C |
| InChI | InChI=1S/C29H23F3N2O4S/c1-16-11-21-22(34(26(36)28(21,2)3)15-17-7-5-4-6-8-17)14-19(16)20-12-18(9-10-23(20)38-29(30,31)32)13-24-25(35)33-27(37)39-24/h4-14H,15H2,1-3H3,(H,33,35,37) |
| InChIKey | JUYPRBPAOWLCMA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|