C49H36N4NiO — CID 85333583
nickel(2+);[5,10,15,20-tetrakis(4-methylphenyl)porphyrin-24-id-2-ylidene]methanolate (PubChem CID 85333583) has the molecular formula C49H36N4NiO and a molecular weight of 755.55 g/mol. Its IUPAC name is nickel(2+);[5,10,15,20-tetrakis(4-methylphenyl)porphyrin-24-id-2-ylidene]methanolate.
| Compound Name | nickel(2+);[5,10,15,20-tetrakis(4-methylphenyl)porphyrin-24-id-2-ylidene]methanolate |
|---|---|
| PubChem CID | 85333583 |
| Molecular Formula | C49H36N4NiO |
| Molecular Weight | 755.55 g/mol |
| Exact Mass | 754.22 |
| IUPAC Name | nickel(2+);[5,10,15,20-tetrakis(4-methylphenyl)porphyrin-24-id-2-ylidene]methanolate |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=c3/cc/c([n-]3)=C(\c3ccc(C)cc3)C3=NC2=CC3=C[O-])cc1.[Ni+2] |
| InChI | InChI=1S/C49H37N4O.Ni/c1-29-5-13-33(14-6-29)45-38-21-22-39(50-38)46(34-15-7-30(2)8-16-34)41-25-26-43(52-41)48(36-19-11-32(4)12-20-36)49-37(28-54)27-44(53-49)47(42-24-23-40(45)51-42)35-17-9-31(3)10-18-35;/h5-28H,1-4H3,(H-,50,51,52,53,54);/q-1;+2/p-1/b45-38-,45-40-,46-39-,46-41-,47-42-,47-44-,48-43-,49-48-; |
| InChIKey | QNDJPLPWYULAPC-KOQCXKGYSA-M |
| XLogP | 7.71 |
| TPSA | 74.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.55 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|