About 2-methylpropylthiourea
2-methylpropylthiourea (PubChem CID 853362) has the molecular formula C5H12N2S
and a molecular weight of 132.23 g/mol. Its IUPAC name is 2-methylpropylthiourea.
Molecular Properties
| Compound Name | 2-methylpropylthiourea |
| PubChem CID | 853362 |
| Molecular Formula | C5H12N2S |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2-methylpropylthiourea |
| SMILES | CC(C)CNC(N)=S |
| InChI | InChI=1S/C5H12N2S/c1-4(2)3-7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8) |
| InChIKey | RGTMILHZLXZRGF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylthiourea?
The IUPAC name of 2-methylpropylthiourea (CID 853362) is 2-methylpropylthiourea.
What is the SMILES notation for 2-methylpropylthiourea?
The canonical SMILES for 2-methylpropylthiourea is CC(C)CNC(N)=S.
What is the InChIKey of 2-methylpropylthiourea?
The InChIKey is RGTMILHZLXZRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2S/c1-4(2)3-7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8).
What are the key properties of 2-methylpropylthiourea?
2-methylpropylthiourea has a molecular weight of 132.23 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylthiourea is sourced from PubChem (CID 853362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).