About [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate
[4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate (PubChem CID 85337090) has the molecular formula C24H41N3O4S
and a molecular weight of 467.68 g/mol. Its IUPAC name is [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate.
Molecular Properties
| Compound Name | [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate |
| PubChem CID | 85337090 |
| Molecular Formula | C24H41N3O4S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate |
| SMILES | CCCN(CCCCN1CCNCCC1=O)C(C)Cc1ccc(OS(=O)(=O)C(C)C)cc1 |
| InChI | InChI=1S/C24H41N3O4S/c1-5-15-26(16-6-7-17-27-18-14-25-13-12-24(27)28)21(4)19-22-8-10-23(11-9-22)31-32(29,30)20(2)3/h8-11,20-21,25H,5-7,12-19H2,1-4H3 |
| InChIKey | DNEXZNZITIKTDG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate?
The IUPAC name of [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate (CID 85337090) is [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate.
What is the SMILES notation for [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate?
The canonical SMILES for [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate is CCCN(CCCCN1CCNCCC1=O)C(C)Cc1ccc(OS(=O)(=O)C(C)C)cc1.
What is the InChIKey of [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate?
The InChIKey is DNEXZNZITIKTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H41N3O4S/c1-5-15-26(16-6-7-17-27-18-14-25-13-12-24(27)28)21(4)19-22-8-10-23(11-9-22)31-32(29,30)20(2)3/h8-11,20-21,25H,5-7,12-19H2,1-4H3.
What are the key properties of [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate?
[4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate has a molecular weight of 467.68 g/mol, XLogP of 3.05, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-(7-oxo-1,4-diazepan-1-yl)butyl-propylamino]propyl]phenyl] propane-2-sulfonate is sourced from PubChem (CID 85337090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).