C34H27Cl2N3O3S — CID 85338322
3-[5-[2-[2-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl]-4-oxo-2-[4-(2-phenylethynyl)phenyl]-1,3-thiazolidin-3-yl]benzamide (PubChem CID 85338322) has the molecular formula C34H27Cl2N3O3S and a molecular weight of 628.58 g/mol. Its IUPAC name is 3-[5-[2-[2-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl]-4-oxo-2-[4-(2-phenylethynyl)phenyl]-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 3-[5-[2-[2-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl]-4-oxo-2-[4-(2-phenylethynyl)phenyl]-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 85338322 |
| Molecular Formula | C34H27Cl2N3O3S |
| Molecular Weight | 628.58 g/mol |
| Exact Mass | 627.12 |
| IUPAC Name | 3-[5-[2-[2-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl]-4-oxo-2-[4-(2-phenylethynyl)phenyl]-1,3-thiazolidin-3-yl]benzamide |
| SMILES | NC(=O)c1cccc(N2C(=O)C(CC(=O)NCCc3ccc(Cl)c(Cl)c3)SC2c2ccc(C#Cc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C34H27Cl2N3O3S/c35-28-16-13-24(19-29(28)36)17-18-38-31(40)21-30-33(42)39(27-8-4-7-26(20-27)32(37)41)34(43-30)25-14-11-23(12-15-25)10-9-22-5-2-1-3-6-22/h1-8,11-16,19-20,30,34H,17-18,21H2,(H2,37,41)(H,38,40) |
| InChIKey | SVNKZPBBEWWCDQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|