C15H26O3 — CID 85340825
3,3,5,7b-tetramethyl-1,1a,2,4,5,6,7,7a-octahydrocyclopropa[h]azulene-2,4a,6-triol (PubChem CID 85340825) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3,3,5,7b-tetramethyl-1,1a,2,4,5,6,7,7a-octahydrocyclopropa[h]azulene-2,4a,6-triol.
| Compound Name | 3,3,5,7b-tetramethyl-1,1a,2,4,5,6,7,7a-octahydrocyclopropa[h]azulene-2,4a,6-triol |
|---|---|
| PubChem CID | 85340825 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3,3,5,7b-tetramethyl-1,1a,2,4,5,6,7,7a-octahydrocyclopropa[h]azulene-2,4a,6-triol |
| SMILES | CC1C(O)CC2C3(C)CC3C(O)C(C)(C)CC12O |
| InChI | InChI=1S/C15H26O3/c1-8-10(16)5-11-14(4)6-9(14)12(17)13(2,3)7-15(8,11)18/h8-12,16-18H,5-7H2,1-4H3 |
| InChIKey | IFIHWZZZFAACPJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |