About 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol
2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol (PubChem CID 853426) has the molecular formula C15H12N4O
and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol |
| PubChem CID | 853426 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol |
| SMILES | Nc1nc(-c2ccccc2)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C15H12N4O/c16-15-18-13(10-6-2-1-3-7-10)17-14(19-15)11-8-4-5-9-12(11)20/h1-9,20H,(H2,16,17,18,19) |
| InChIKey | PYRIHWXWFMRKLX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol?
The IUPAC name of 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol (CID 853426) is 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol.
What is the SMILES notation for 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol?
The canonical SMILES for 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol is Nc1nc(-c2ccccc2)nc(-c2ccccc2O)n1.
What is the InChIKey of 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol?
The InChIKey is PYRIHWXWFMRKLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O/c16-15-18-13(10-6-2-1-3-7-10)17-14(19-15)11-8-4-5-9-12(11)20/h1-9,20H,(H2,16,17,18,19).
What are the key properties of 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol?
2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol has a molecular weight of 264.29 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-6-phenyl-1,3,5-triazin-2-yl)phenol is sourced from PubChem (CID 853426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).