About 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one
8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 85344427) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
Analyze 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one?
The IUPAC name of 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (CID 85344427) is 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
What is the SMILES notation for 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one?
The canonical SMILES for 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one is O=C1CCC2C(O)CCCN12.
What is the InChIKey of 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one?
The InChIKey is KTABOEKIAVLJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c10-7-2-1-5-9-6(7)3-4-8(9)11/h6-7,10H,1-5H2.
What are the key properties of 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one?
8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one has a molecular weight of 155.20 g/mol, XLogP of 0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one is sourced from PubChem (CID 85344427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).