C9H15NO2 — CID 85344653
3-propyl-3,3a,4,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-one (PubChem CID 85344653) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 3-propyl-3,3a,4,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-one.
| Compound Name | 3-propyl-3,3a,4,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 85344653 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 3-propyl-3,3a,4,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-one |
| SMILES | CCCC1C(=O)OC2CCNC21 |
| InChI | InChI=1S/C9H15NO2/c1-2-3-6-8-7(4-5-10-8)12-9(6)11/h6-8,10H,2-5H2,1H3 |
| InChIKey | PLKIGWFTMCOTBG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |