C27H25NO5 — CID 85346966
methyl 3-[2,2-diphenylethenyl-(2-methoxy-2-oxo-1-phenylethyl)amino]-3-oxopropanoate (PubChem CID 85346966) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is methyl 3-[2,2-diphenylethenyl-(2-methoxy-2-oxo-1-phenylethyl)amino]-3-oxopropanoate.
| Compound Name | methyl 3-[2,2-diphenylethenyl-(2-methoxy-2-oxo-1-phenylethyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 85346966 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | methyl 3-[2,2-diphenylethenyl-(2-methoxy-2-oxo-1-phenylethyl)amino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)N(C=C(c1ccccc1)c1ccccc1)C(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C27H25NO5/c1-32-25(30)18-24(29)28(26(27(31)33-2)22-16-10-5-11-17-22)19-23(20-12-6-3-7-13-20)21-14-8-4-9-15-21/h3-17,19,26H,18H2,1-2H3 |
| InChIKey | WTBQRDUFCPEZCV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|