About 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one
2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one (PubChem CID 85348725) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one |
| PubChem CID | 85348725 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one |
| SMILES | C=CC=CC1C=C(C=CC)C(=O)O1 |
| InChI | InChI=1S/C11H12O2/c1-3-5-7-10-8-9(6-4-2)11(12)13-10/h3-8,10H,1H2,2H3 |
| InChIKey | QGERFWROLPOCAG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one?
The IUPAC name of 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one (CID 85348725) is 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one.
What is the SMILES notation for 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one?
The canonical SMILES for 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one is C=CC=CC1C=C(C=CC)C(=O)O1.
What is the InChIKey of 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one?
The InChIKey is QGERFWROLPOCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-3-5-7-10-8-9(6-4-2)11(12)13-10/h3-8,10H,1H2,2H3.
What are the key properties of 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one?
2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one has a molecular weight of 176.21 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,3-dienyl-4-prop-1-enyl-2H-furan-5-one is sourced from PubChem (CID 85348725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).