C16H18N2O3 — CID 85349615
6-benzyl-4-pent-4-enylpiperazine-2,3,5-trione (PubChem CID 85349615) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 6-benzyl-4-pent-4-enylpiperazine-2,3,5-trione.
| Compound Name | 6-benzyl-4-pent-4-enylpiperazine-2,3,5-trione |
|---|---|
| PubChem CID | 85349615 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 6-benzyl-4-pent-4-enylpiperazine-2,3,5-trione |
| SMILES | C=CCCCN1C(=O)C(=O)NC(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H18N2O3/c1-2-3-7-10-18-15(20)13(17-14(19)16(18)21)11-12-8-5-4-6-9-12/h2,4-6,8-9,13H,1,3,7,10-11H2,(H,17,19) |
| InChIKey | NIRYILUAPYHRRX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|