C18H26OSi — CID 85349623
3,3-dimethyl-6-methylidene-8a-(2-trimethylsilylethynyl)-2,4,4a,5-tetrahydronaphthalen-1-one (PubChem CID 85349623) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is 3,3-dimethyl-6-methylidene-8a-(2-trimethylsilylethynyl)-2,4,4a,5-tetrahydronaphthalen-1-one.
| Compound Name | 3,3-dimethyl-6-methylidene-8a-(2-trimethylsilylethynyl)-2,4,4a,5-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 85349623 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 3,3-dimethyl-6-methylidene-8a-(2-trimethylsilylethynyl)-2,4,4a,5-tetrahydronaphthalen-1-one |
| SMILES | C=C1C=CC2(C#C[Si](C)(C)C)C(=O)CC(C)(C)CC2C1 |
| InChI | InChI=1S/C18H26OSi/c1-14-7-8-18(9-10-20(4,5)6)15(11-14)12-17(2,3)13-16(18)19/h7-8,15H,1,11-13H2,2-6H3 |
| InChIKey | HURMAGCLPHPIJT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|