C16H17N3O4S — CID 8535146
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-ethylthiadiazole-5-carboxylate (PubChem CID 8535146) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-ethylthiadiazole-5-carboxylate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8535146 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)O[C@H](C)C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C16H17N3O4S/c1-4-13-14(24-19-18-13)16(22)23-10(3)15(21)17-12-7-5-6-11(8-12)9(2)20/h5-8,10H,4H2,1-3H3,(H,17,21)/t10-/m1/s1 |
| InChIKey | BXOLTZBQODPKFU-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |