C21H27N3O — CID 853521
4-(benzotriazol-1-ylmethyl)-2,6-ditert-butylphenol (PubChem CID 853521) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-(benzotriazol-1-ylmethyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(benzotriazol-1-ylmethyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 853521 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 4-(benzotriazol-1-ylmethyl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(Cn2nnc3ccccc32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H27N3O/c1-20(2,3)15-11-14(12-16(19(15)25)21(4,5)6)13-24-18-10-8-7-9-17(18)22-23-24/h7-12,25H,13H2,1-6H3 |
| InChIKey | GWSPSHZOUXLFPN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |