About prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate
prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate (PubChem CID 85353315) has the molecular formula C9H14O4S2
and a molecular weight of 250.34 g/mol. Its IUPAC name is prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate.
Molecular Properties
| Compound Name | prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate |
| PubChem CID | 85353315 |
| Molecular Formula | C9H14O4S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate |
| SMILES | C=CCOS(=O)(=O)OCC=CSCC=C |
| InChI | InChI=1S/C9H14O4S2/c1-3-6-12-15(10,11)13-7-5-9-14-8-4-2/h3-5,9H,1-2,6-8H2 |
| InChIKey | LRKSHTQJEZSHGG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate?
The IUPAC name of prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate (CID 85353315) is prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate.
What is the SMILES notation for prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate?
The canonical SMILES for prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate is C=CCOS(=O)(=O)OCC=CSCC=C.
What is the InChIKey of prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate?
The InChIKey is LRKSHTQJEZSHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S2/c1-3-6-12-15(10,11)13-7-5-9-14-8-4-2/h3-5,9H,1-2,6-8H2.
What are the key properties of prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate?
prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate has a molecular weight of 250.34 g/mol, XLogP of 1.88, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 3-prop-2-enylsulfanylprop-2-enyl sulfate is sourced from PubChem (CID 85353315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).