About 4-(benzylamino)benzoic acid
4-(benzylamino)benzoic acid (PubChem CID 853546) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-(benzylamino)benzoic acid.
Molecular Properties
| Compound Name | 4-(benzylamino)benzoic acid |
| PubChem CID | 853546 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 4-(benzylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H13NO2/c16-14(17)12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,15H,10H2,(H,16,17) |
| InChIKey | NYNAMTQEBMCHNG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(benzylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzylamino)benzoic acid?
The IUPAC name of 4-(benzylamino)benzoic acid (CID 853546) is 4-(benzylamino)benzoic acid.
What is the SMILES notation for 4-(benzylamino)benzoic acid?
The canonical SMILES for 4-(benzylamino)benzoic acid is O=C(O)c1ccc(NCc2ccccc2)cc1.
What is the InChIKey of 4-(benzylamino)benzoic acid?
The InChIKey is NYNAMTQEBMCHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c16-14(17)12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,15H,10H2,(H,16,17).
What are the key properties of 4-(benzylamino)benzoic acid?
4-(benzylamino)benzoic acid has a molecular weight of 227.26 g/mol, XLogP of 3.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzylamino)benzoic acid is sourced from PubChem (CID 853546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).