C15H13F2N3O5S — CID 8535538
[2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate (PubChem CID 8535538) has the molecular formula C15H13F2N3O5S and a molecular weight of 385.35 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate.
| Compound Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8535538 |
| Molecular Formula | C15H13F2N3O5S |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)OCC(=O)NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H13F2N3O5S/c1-2-10-12(26-20-19-10)14(23)24-7-11(21)18-13(22)8-3-5-9(6-4-8)25-15(16)17/h3-6,15H,2,7H2,1H3,(H,18,21,22) |
| InChIKey | CIPLWGKGICHRPL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |