C29H44O6 — CID 85355544
2,3,8-trihydroxy-4,6a,6b,11,11,14b-hexamethyl-7-oxo-1,2,3,4a,5,6,8,8a,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylic acid (PubChem CID 85355544) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is 2,3,8-trihydroxy-4,6a,6b,11,11,14b-hexamethyl-7-oxo-1,2,3,4a,5,6,8,8a,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylic acid.
| Compound Name | 2,3,8-trihydroxy-4,6a,6b,11,11,14b-hexamethyl-7-oxo-1,2,3,4a,5,6,8,8a,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylic acid |
|---|---|
| PubChem CID | 85355544 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 2,3,8-trihydroxy-4,6a,6b,11,11,14b-hexamethyl-7-oxo-1,2,3,4a,5,6,8,8a,9,10,12,12a,14,14a-tetradecahydropicene-4-carboxylic acid |
| SMILES | CC1(C)CCC2C(O)C(=O)C3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(C(=O)O)C5CCC43C)C2C1 |
| InChI | InChI=1S/C29H44O6/c1-25(2)11-9-15-16(13-25)17-7-8-19-26(3)14-18(30)22(32)28(5,24(34)35)20(26)10-12-27(19,4)29(17,6)23(33)21(15)31/h7,15-16,18-22,30-32H,8-14H2,1-6H3,(H,34,35) |
| InChIKey | PSSJSAXYGICONF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|