ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate

C11H14O3 — CID 85356982

IUPACethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate
SMILESCCOC(=O)C1C(=O)C=C2CCCC21
InChIInChI=1S/C11H14O3/c1-2-14-11(13)10-8-5-3-4-7(8)6-9(10)12/h6,8,10H,2-5H2,1H3
InChIKeyGVHBRDIHVSMSOG-UHFFFAOYSA-N
MW194.23 g/mol
LogP1.47
Rot. Bonds2

About ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate

ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate (PubChem CID 85356982) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate.

Molecular Properties

Compound Nameethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate
PubChem CID85356982
Molecular FormulaC11H14O3
Molecular Weight194.23 g/mol
Exact Mass194.09
IUPAC Nameethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate
SMILESCCOC(=O)C1C(=O)C=C2CCCC21
InChIInChI=1S/C11H14O3/c1-2-14-11(13)10-8-5-3-4-7(8)6-9(10)12/h6,8,10H,2-5H2,1H3
InChIKeyGVHBRDIHVSMSOG-UHFFFAOYSA-N
XLogP1.47
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 51.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate?
The IUPAC name of ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate (CID 85356982) is ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate.
What is the SMILES notation for ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate?
The canonical SMILES for ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate is CCOC(=O)C1C(=O)C=C2CCCC21.
What is the InChIKey of ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate?
The InChIKey is GVHBRDIHVSMSOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-14-11(13)10-8-5-3-4-7(8)6-9(10)12/h6,8,10H,2-5H2,1H3.
What are the key properties of ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate?
ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate has a molecular weight of 194.23 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxo-4,5,6,6a-tetrahydro-1H-pentalene-1-carboxylate is sourced from PubChem (CID 85356982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).