trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid

C7H12O3 — CID 853571

IUPACtrans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid
SMILESO=C(O)[C@@H]1CCCC[C@H]1O
InChIInChI=1S/C7H12O3/c8-6-4-2-1-3-5(6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6-/m1/s1
InChIKeySNKAANHOVFZAMR-PHDIDXHHSA-N
MW144.17 g/mol
LogP0.62
Rot. Bonds1

About trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid

trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid (PubChem CID 853571) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid.

Molecular Properties

Compound Nametrans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid
PubChem CID853571
Molecular FormulaC7H12O3
Molecular Weight144.17 g/mol
Exact Mass144.08
IUPAC Nametrans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid
SMILESO=C(O)[C@@H]1CCCC[C@H]1O
InChIInChI=1S/C7H12O3/c8-6-4-2-1-3-5(6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6-/m1/s1
InChIKeySNKAANHOVFZAMR-PHDIDXHHSA-N
XLogP0.62
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.17
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid?
The IUPAC name of trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid (CID 853571) is trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid is O=C(O)[C@@H]1CCCC[C@H]1O.
What is the InChIKey of trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid?
The InChIKey is SNKAANHOVFZAMR-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H12O3/c8-6-4-2-1-3-5(6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6-/m1/s1.
What are the key properties of trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid?
trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid has a molecular weight of 144.17 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-hydroxycyclohexane-1-carboxylic acid is sourced from PubChem (CID 853571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).