C20H23NO4 — CID 8535763
[2-oxo-2-(2-phenoxyethylamino)ethyl] 2-(3,4-dimethylphenyl)acetate (PubChem CID 8535763) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-(3,4-dimethylphenyl)acetate.
| Compound Name | [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-(3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 8535763 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-(3,4-dimethylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCC(=O)NCCOc2ccccc2)cc1C |
| InChI | InChI=1S/C20H23NO4/c1-15-8-9-17(12-16(15)2)13-20(23)25-14-19(22)21-10-11-24-18-6-4-3-5-7-18/h3-9,12H,10-11,13-14H2,1-2H3,(H,21,22) |
| InChIKey | NPQNYUKWIJJPSB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|