C18H22N2O3 — CID 85358055
5-[2-(1,3-dioxolan-2-yl)ethyl]-3-phenyl-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazole-5-carbonitrile (PubChem CID 85358055) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-[2-(1,3-dioxolan-2-yl)ethyl]-3-phenyl-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazole-5-carbonitrile.
| Compound Name | 5-[2-(1,3-dioxolan-2-yl)ethyl]-3-phenyl-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazole-5-carbonitrile |
|---|---|
| PubChem CID | 85358055 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 5-[2-(1,3-dioxolan-2-yl)ethyl]-3-phenyl-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazole-5-carbonitrile |
| SMILES | N#CC1(CCC2OCCO2)CCC2OCC(c3ccccc3)N21 |
| InChI | InChI=1S/C18H22N2O3/c19-13-18(9-7-17-21-10-11-22-17)8-6-16-20(18)15(12-23-16)14-4-2-1-3-5-14/h1-5,15-17H,6-12H2 |
| InChIKey | PLSDLYCKROZYKK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |