About 9-acetyl-3,4-dihydro-2H-carbazol-1-one
9-acetyl-3,4-dihydro-2H-carbazol-1-one (PubChem CID 853608) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is 9-acetyl-3,4-dihydro-2H-carbazol-1-one.
Molecular Properties
| Compound Name | 9-acetyl-3,4-dihydro-2H-carbazol-1-one |
| PubChem CID | 853608 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 9-acetyl-3,4-dihydro-2H-carbazol-1-one |
| SMILES | CC(=O)n1c2c(c3ccccc31)CCCC2=O |
| InChI | InChI=1S/C14H13NO2/c1-9(16)15-12-7-3-2-5-10(12)11-6-4-8-13(17)14(11)15/h2-3,5,7H,4,6,8H2,1H3 |
| InChIKey | MIGJEXKBUJPKJF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-acetyl-3,4-dihydro-2H-carbazol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-acetyl-3,4-dihydro-2H-carbazol-1-one?
The IUPAC name of 9-acetyl-3,4-dihydro-2H-carbazol-1-one (CID 853608) is 9-acetyl-3,4-dihydro-2H-carbazol-1-one.
What is the SMILES notation for 9-acetyl-3,4-dihydro-2H-carbazol-1-one?
The canonical SMILES for 9-acetyl-3,4-dihydro-2H-carbazol-1-one is CC(=O)n1c2c(c3ccccc31)CCCC2=O.
What is the InChIKey of 9-acetyl-3,4-dihydro-2H-carbazol-1-one?
The InChIKey is MIGJEXKBUJPKJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c1-9(16)15-12-7-3-2-5-10(12)11-6-4-8-13(17)14(11)15/h2-3,5,7H,4,6,8H2,1H3.
What are the key properties of 9-acetyl-3,4-dihydro-2H-carbazol-1-one?
9-acetyl-3,4-dihydro-2H-carbazol-1-one has a molecular weight of 227.26 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-acetyl-3,4-dihydro-2H-carbazol-1-one is sourced from PubChem (CID 853608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).