About cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one
cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one (PubChem CID 853621) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one |
| PubChem CID | 853621 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one |
| SMILES | CN(C)C[C@H]1CCC[C@@H](CN(C)C)C1=O |
| InChI | InChI=1S/C12H24N2O/c1-13(2)8-10-6-5-7-11(12(10)15)9-14(3)4/h10-11H,5-9H2,1-4H3/t10-,11+ |
| InChIKey | WFFCWXMFKGCIGF-PHIMTYICSA-N |
| XLogP | 1.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one?
The IUPAC name of cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one (CID 853621) is cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one.
What is the SMILES notation for cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one?
The canonical SMILES for cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one is CN(C)C[C@H]1CCC[C@@H](CN(C)C)C1=O.
What is the InChIKey of cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one?
The InChIKey is WFFCWXMFKGCIGF-PHIMTYICSA-N. The full InChI is InChI=1S/C12H24N2O/c1-13(2)8-10-6-5-7-11(12(10)15)9-14(3)4/h10-11H,5-9H2,1-4H3/t10-,11+.
What are the key properties of cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one?
cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one has a molecular weight of 212.34 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,6R)-2,6-bis[(dimethylamino)methyl]cyclohexan-1-one is sourced from PubChem (CID 853621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).