About ethyl nona-6,8-dienoate
ethyl nona-6,8-dienoate (PubChem CID 85362232) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is ethyl nona-6,8-dienoate.
Molecular Properties
| Compound Name | ethyl nona-6,8-dienoate |
| PubChem CID | 85362232 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | ethyl nona-6,8-dienoate |
| SMILES | C=CC=CCCCCC(=O)OCC |
| InChI | InChI=1S/C11H18O2/c1-3-5-6-7-8-9-10-11(12)13-4-2/h3,5-6H,1,4,7-10H2,2H3 |
| InChIKey | DVXVNHFTLXKJFA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl nona-6,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl nona-6,8-dienoate?
The IUPAC name of ethyl nona-6,8-dienoate (CID 85362232) is ethyl nona-6,8-dienoate.
What is the SMILES notation for ethyl nona-6,8-dienoate?
The canonical SMILES for ethyl nona-6,8-dienoate is C=CC=CCCCCC(=O)OCC.
What is the InChIKey of ethyl nona-6,8-dienoate?
The InChIKey is DVXVNHFTLXKJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-3-5-6-7-8-9-10-11(12)13-4-2/h3,5-6H,1,4,7-10H2,2H3.
What are the key properties of ethyl nona-6,8-dienoate?
ethyl nona-6,8-dienoate has a molecular weight of 182.26 g/mol, XLogP of 2.85, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl nona-6,8-dienoate is sourced from PubChem (CID 85362232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).