About (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate
(11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate (PubChem CID 85362376) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate |
| PubChem CID | 85362376 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate |
| SMILES | COC(=O)CCCCCCCCCCOC(=O)C1=CC=CC1=[N+]=[N-] |
| InChI | InChI=1S/C18H26N2O4/c1-23-17(21)13-8-6-4-2-3-5-7-9-14-24-18(22)15-11-10-12-16(15)20-19/h10-12H,2-9,13-14H2,1H3 |
| InChIKey | MEGSOXUUSXHZAC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate?
The IUPAC name of (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate (CID 85362376) is (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate.
What is the SMILES notation for (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate?
The canonical SMILES for (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate is COC(=O)CCCCCCCCCCOC(=O)C1=CC=CC1=[N+]=[N-].
What is the InChIKey of (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate?
The InChIKey is MEGSOXUUSXHZAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O4/c1-23-17(21)13-8-6-4-2-3-5-7-9-14-24-18(22)15-11-10-12-16(15)20-19/h10-12H,2-9,13-14H2,1H3.
What are the key properties of (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate?
(11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate has a molecular weight of 334.42 g/mol, XLogP of 3.38, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (11-methoxy-11-oxoundecyl) 5-diazocyclopenta-1,3-diene-1-carboxylate is sourced from PubChem (CID 85362376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).