C6H10N2O2 — CID 853633
(5S)-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 853633) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is (5S)-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 853633 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (5S)-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C6H10N2O2/c1-3(2)4-5(9)8-6(10)7-4/h3-4H,1-2H3,(H2,7,8,9,10)/t4-/m0/s1 |
| InChIKey | PBNUQCWZHRMSMS-BYPYZUCNSA-N |
| XLogP | -0.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|