About 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one
4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one (PubChem CID 85365068) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one.
Molecular Properties
| Compound Name | 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one |
| PubChem CID | 85365068 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one |
| SMILES | O=C1OC2C=CC1C1COCC21 |
| InChI | InChI=1S/C9H10O3/c10-9-5-1-2-8(12-9)7-4-11-3-6(5)7/h1-2,5-8H,3-4H2 |
| InChIKey | AQYSHLYNOXAZMR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one?
The IUPAC name of 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one (CID 85365068) is 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one.
What is the SMILES notation for 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one?
The canonical SMILES for 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one is O=C1OC2C=CC1C1COCC21.
What is the InChIKey of 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one?
The InChIKey is AQYSHLYNOXAZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-9-5-1-2-8(12-9)7-4-11-3-6(5)7/h1-2,5-8H,3-4H2.
What are the key properties of 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one?
4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one has a molecular weight of 166.18 g/mol, XLogP of 0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dioxatricyclo[5.2.2.02,6]undec-10-en-9-one is sourced from PubChem (CID 85365068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).