About pent-3-enoate;triethylazanium
pent-3-enoate;triethylazanium (PubChem CID 85365224) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is pent-3-enoate;triethylazanium.
Molecular Properties
| Compound Name | pent-3-enoate;triethylazanium |
| PubChem CID | 85365224 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | pent-3-enoate;triethylazanium |
| SMILES | CC=CCC(=O)[O-].CC[NH+](CC)CC |
| InChI | InChI=1S/C6H15N.C5H8O2/c1-4-7(5-2)6-3;1-2-3-4-5(6)7/h4-6H2,1-3H3;2-3H,4H2,1H3,(H,6,7) |
| InChIKey | MRTISLFUZIGOTH-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-3-enoate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-3-enoate;triethylazanium?
The IUPAC name of pent-3-enoate;triethylazanium (CID 85365224) is pent-3-enoate;triethylazanium.
What is the SMILES notation for pent-3-enoate;triethylazanium?
The canonical SMILES for pent-3-enoate;triethylazanium is CC=CCC(=O)[O-].CC[NH+](CC)CC.
What is the InChIKey of pent-3-enoate;triethylazanium?
The InChIKey is MRTISLFUZIGOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H8O2/c1-4-7(5-2)6-3;1-2-3-4-5(6)7/h4-6H2,1-3H3;2-3H,4H2,1H3,(H,6,7).
What are the key properties of pent-3-enoate;triethylazanium?
pent-3-enoate;triethylazanium has a molecular weight of 201.31 g/mol, XLogP of -0.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pent-3-enoate;triethylazanium is sourced from PubChem (CID 85365224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).