About 5-(bromomethyl)oxolane-2,3,4-triol
5-(bromomethyl)oxolane-2,3,4-triol (PubChem CID 85365304) has the molecular formula C5H9BrO4
and a molecular weight of 213.03 g/mol. Its IUPAC name is 5-(bromomethyl)oxolane-2,3,4-triol.
Molecular Properties
| Compound Name | 5-(bromomethyl)oxolane-2,3,4-triol |
| PubChem CID | 85365304 |
| Molecular Formula | C5H9BrO4 |
| Molecular Weight | 213.03 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 5-(bromomethyl)oxolane-2,3,4-triol |
| SMILES | OC1OC(CBr)C(O)C1O |
| InChI | InChI=1S/C5H9BrO4/c6-1-2-3(7)4(8)5(9)10-2/h2-5,7-9H,1H2 |
| InChIKey | VICOKPRQEGIZIT-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.03 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)oxolane-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)oxolane-2,3,4-triol?
The IUPAC name of 5-(bromomethyl)oxolane-2,3,4-triol (CID 85365304) is 5-(bromomethyl)oxolane-2,3,4-triol.
What is the SMILES notation for 5-(bromomethyl)oxolane-2,3,4-triol?
The canonical SMILES for 5-(bromomethyl)oxolane-2,3,4-triol is OC1OC(CBr)C(O)C1O.
What is the InChIKey of 5-(bromomethyl)oxolane-2,3,4-triol?
The InChIKey is VICOKPRQEGIZIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BrO4/c6-1-2-3(7)4(8)5(9)10-2/h2-5,7-9H,1H2.
What are the key properties of 5-(bromomethyl)oxolane-2,3,4-triol?
5-(bromomethyl)oxolane-2,3,4-triol has a molecular weight of 213.03 g/mol, XLogP of -1.18, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)oxolane-2,3,4-triol is sourced from PubChem (CID 85365304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).