About 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene
9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 85365383) has the molecular formula C16H14O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
Molecular Properties
| Compound Name | 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| PubChem CID | 85365383 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | c1ccc(C2CC3OC2c2ccccc23)cc1 |
| InChI | InChI=1S/C16H14O/c1-2-6-11(7-3-1)14-10-15-12-8-4-5-9-13(12)16(14)17-15/h1-9,14-16H,10H2 |
| InChIKey | BBLKKQFZFAOQRP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene?
The IUPAC name of 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene (CID 85365383) is 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
What is the SMILES notation for 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene?
The canonical SMILES for 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene is c1ccc(C2CC3OC2c2ccccc23)cc1.
What is the InChIKey of 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene?
The InChIKey is BBLKKQFZFAOQRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O/c1-2-6-11(7-3-1)14-10-15-12-8-4-5-9-13(12)16(14)17-15/h1-9,14-16H,10H2.
What are the key properties of 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene?
9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene has a molecular weight of 222.29 g/mol, XLogP of 3.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene is sourced from PubChem (CID 85365383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).