About 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one
12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one (PubChem CID 85365399) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one.
Molecular Properties
| Compound Name | 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one |
| PubChem CID | 85365399 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one |
| SMILES | CC(=O)CCCC(C)=CCCC(C)=CCO |
| InChI | InChI=1S/C14H24O2/c1-12(8-5-9-14(3)16)6-4-7-13(2)10-11-15/h6,10,15H,4-5,7-9,11H2,1-3H3 |
| InChIKey | VZDNKMDQWSQDRS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one?
The IUPAC name of 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one (CID 85365399) is 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one.
What is the SMILES notation for 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one?
The canonical SMILES for 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one is CC(=O)CCCC(C)=CCCC(C)=CCO.
What is the InChIKey of 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one?
The InChIKey is VZDNKMDQWSQDRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-12(8-5-9-14(3)16)6-4-7-13(2)10-11-15/h6,10,15H,4-5,7-9,11H2,1-3H3.
What are the key properties of 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one?
12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one has a molecular weight of 224.34 g/mol, XLogP of 3.41, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one is sourced from PubChem (CID 85365399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).