C17H24O3 — CID 85365907
4,4,7,10,10-pentamethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-9-one (PubChem CID 85365907) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4,4,7,10,10-pentamethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-9-one.
| Compound Name | 4,4,7,10,10-pentamethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-9-one |
|---|---|
| PubChem CID | 85365907 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4,4,7,10,10-pentamethyl-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-9-one |
| SMILES | CC1(C)OC2C3C=CC(C)(C2O1)C1C(=O)C(C)(C)CC31 |
| InChI | InChI=1S/C17H24O3/c1-15(2)8-10-9-6-7-17(5,11(10)13(15)18)14-12(9)19-16(3,4)20-14/h6-7,9-12,14H,8H2,1-5H3 |
| InChIKey | KOFYNOGTRCPXSY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|