C15H24O3Si — CID 85370053
5-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 85370053) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is 5-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | 5-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 85370053 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)C1=CC2CC(=O)OC2C1 |
| InChI | InChI=1S/C15H24O3Si/c1-10(18-19(5,6)15(2,3)4)11-7-12-9-14(16)17-13(12)8-11/h7,12-13H,1,8-9H2,2-6H3 |
| InChIKey | HXWHSPUZFQSWOC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|