C20H24O6 — CID 85370969
5,15-dihydroxy-4-(hydroxymethyl)-15-methyl-7-prop-1-en-2-yl-12,17-dioxapentacyclo[8.5.1.12,5.02,8.013,16]heptadeca-3,9-dien-11-one (PubChem CID 85370969) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 5,15-dihydroxy-4-(hydroxymethyl)-15-methyl-7-prop-1-en-2-yl-12,17-dioxapentacyclo[8.5.1.12,5.02,8.013,16]heptadeca-3,9-dien-11-one.
| Compound Name | 5,15-dihydroxy-4-(hydroxymethyl)-15-methyl-7-prop-1-en-2-yl-12,17-dioxapentacyclo[8.5.1.12,5.02,8.013,16]heptadeca-3,9-dien-11-one |
|---|---|
| PubChem CID | 85370969 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 5,15-dihydroxy-4-(hydroxymethyl)-15-methyl-7-prop-1-en-2-yl-12,17-dioxapentacyclo[8.5.1.12,5.02,8.013,16]heptadeca-3,9-dien-11-one |
| SMILES | C=C(C)C1CC2(O)OC3(C=C2CO)C1C=C1C(=O)OC2CC(C)(O)C3C12 |
| InChI | InChI=1S/C20H24O6/c1-9(2)12-6-20(24)10(8-21)5-19(26-20)13(12)4-11-15-14(25-17(11)22)7-18(3,23)16(15)19/h4-5,12-16,21,23-24H,1,6-8H2,2-3H3 |
| InChIKey | GEUDUDDEVTYBEK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|