About 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile
2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile (PubChem CID 8537229) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile |
| PubChem CID | 8537229 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile |
| SMILES | Cc1nn(CC(=O)C(C)(C)C)c(=O)c(C#N)c1C |
| InChI | InChI=1S/C13H17N3O2/c1-8-9(2)15-16(12(18)10(8)6-14)7-11(17)13(3,4)5/h7H2,1-5H3 |
| InChIKey | GSZVDFHDARDDIR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile?
The IUPAC name of 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile (CID 8537229) is 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile.
What is the SMILES notation for 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile?
The canonical SMILES for 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile is Cc1nn(CC(=O)C(C)(C)C)c(=O)c(C#N)c1C.
What is the InChIKey of 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile?
The InChIKey is GSZVDFHDARDDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-8-9(2)15-16(12(18)10(8)6-14)7-11(17)13(3,4)5/h7H2,1-5H3.
What are the key properties of 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile?
2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile has a molecular weight of 247.30 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethyl-2-oxobutyl)-5,6-dimethyl-3-oxopyridazine-4-carbonitrile is sourced from PubChem (CID 8537229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).