C17H20BrN5O — CID 8537300
2-[5-(2-bromophenyl)tetrazol-2-yl]-N-(cyclohexen-1-yl)-N-ethylacetamide (PubChem CID 8537300) has the molecular formula C17H20BrN5O and a molecular weight of 390.29 g/mol. Its IUPAC name is 2-[5-(2-bromophenyl)tetrazol-2-yl]-N-(cyclohexen-1-yl)-N-ethylacetamide.
| Compound Name | 2-[5-(2-bromophenyl)tetrazol-2-yl]-N-(cyclohexen-1-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 8537300 |
| Molecular Formula | C17H20BrN5O |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-[5-(2-bromophenyl)tetrazol-2-yl]-N-(cyclohexen-1-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)Cn1nnc(-c2ccccc2Br)n1)C1=CCCCC1 |
| InChI | InChI=1S/C17H20BrN5O/c1-2-22(13-8-4-3-5-9-13)16(24)12-23-20-17(19-21-23)14-10-6-7-11-15(14)18/h6-8,10-11H,2-5,9,12H2,1H3 |
| InChIKey | SRLKWTKGPXQQFM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |