About tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate
tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate (PubChem CID 85374055) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
| PubChem CID | 85374055 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12CC3CCCC3(CCC1=O)O2 |
| InChI | InChI=1S/C15H22O4/c1-13(2,3)18-12(17)15-9-10-5-4-7-14(10,19-15)8-6-11(15)16/h10H,4-9H2,1-3H3 |
| InChIKey | FNVBBKJSAGPGHN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate?
The IUPAC name of tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate (CID 85374055) is tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate.
What is the SMILES notation for tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate?
The canonical SMILES for tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate is CC(C)(C)OC(=O)C12CC3CCCC3(CCC1=O)O2.
What is the InChIKey of tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate?
The InChIKey is FNVBBKJSAGPGHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-13(2,3)18-12(17)15-9-10-5-4-7-14(10,19-15)8-6-11(15)16/h10H,4-9H2,1-3H3.
What are the key properties of tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate?
tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate has a molecular weight of 266.34 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-7-carboxylate is sourced from PubChem (CID 85374055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).