About CID 85375488
CID 85375488 (PubChem CID 85375488) has the molecular formula C13H19
and a molecular weight of 175.30 g/mol.
Molecular Properties
| Compound Name | CID 85375488 |
| PubChem CID | 85375488 |
| Molecular Formula | C13H19 |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.15 |
| IUPAC Name | — |
| SMILES | C[CH][CH][CH][C]1[CH]CC2CC1C2(C)C |
| InChI | InChI=1S/C13H19/c1-4-5-6-10-7-8-11-9-12(10)13(11,2)3/h4-7,11-12H,8-9H2,1-3H3 |
| InChIKey | WTKUBGSALWIELL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 85375488 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 85375488?
The IUPAC name of CID 85375488 (CID 85375488) is not available.
What is the SMILES notation for CID 85375488?
The canonical SMILES for CID 85375488 is C[CH][CH][CH][C]1[CH]CC2CC1C2(C)C.
What is the InChIKey of CID 85375488?
The InChIKey is WTKUBGSALWIELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19/c1-4-5-6-10-7-8-11-9-12(10)13(11,2)3/h4-7,11-12H,8-9H2,1-3H3.
What are the key properties of CID 85375488?
CID 85375488 has a molecular weight of 175.30 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 85375488 is sourced from PubChem (CID 85375488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).