About CID 85376790
CID 85376790 (PubChem CID 85376790) has the molecular formula C38H50Cl2Zr
and a molecular weight of 668.95 g/mol.
Molecular Properties
| Compound Name | CID 85376790 |
| PubChem CID | 85376790 |
| Molecular Formula | C38H50Cl2Zr |
| Molecular Weight | 668.95 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | — |
| SMILES | CC1CCC(C(C)C)C([C]2[CH][CH][C]3C=CC=C[C]32)C1.CC1CCC(C(C)C)C([C]2[CH][CH][C]3C=CC=C[C]32)C1.Cl[Zr]Cl |
| InChI | InChI=1S/2C19H25.2ClH.Zr/c2*1-13(2)16-10-8-14(3)12-19(16)18-11-9-15-6-4-5-7-17(15)18;;;/h2*4-7,9,11,13-14,16,19H,8,10,12H2,1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | PJPPWEIHGLZWBM-UHFFFAOYSA-L |
| XLogP | 11.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.95 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 85376790 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 85376790?
The IUPAC name of CID 85376790 (CID 85376790) is not available.
What is the SMILES notation for CID 85376790?
The canonical SMILES for CID 85376790 is CC1CCC(C(C)C)C([C]2[CH][CH][C]3C=CC=C[C]32)C1.CC1CCC(C(C)C)C([C]2[CH][CH][C]3C=CC=C[C]32)C1.Cl[Zr]Cl.
What is the InChIKey of CID 85376790?
The InChIKey is PJPPWEIHGLZWBM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C19H25.2ClH.Zr/c2*1-13(2)16-10-8-14(3)12-19(16)18-11-9-15-6-4-5-7-17(15)18;;;/h2*4-7,9,11,13-14,16,19H,8,10,12H2,1-3H3;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 85376790?
CID 85376790 has a molecular weight of 668.95 g/mol, XLogP of 11.31, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 85376790 is sourced from PubChem (CID 85376790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).