About 2-[(1,3-thiazol-2-ylamino)methyl]phenol
2-[(1,3-thiazol-2-ylamino)methyl]phenol (PubChem CID 853785) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-[(1,3-thiazol-2-ylamino)methyl]phenol.
Molecular Properties
| Compound Name | 2-[(1,3-thiazol-2-ylamino)methyl]phenol |
| PubChem CID | 853785 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-[(1,3-thiazol-2-ylamino)methyl]phenol |
| SMILES | Oc1ccccc1CNc1nccs1 |
| InChI | InChI=1S/C10H10N2OS/c13-9-4-2-1-3-8(9)7-12-10-11-5-6-14-10/h1-6,13H,7H2,(H,11,12) |
| InChIKey | FUVLIIWCXQIRQM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,3-thiazol-2-ylamino)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-thiazol-2-ylamino)methyl]phenol?
The IUPAC name of 2-[(1,3-thiazol-2-ylamino)methyl]phenol (CID 853785) is 2-[(1,3-thiazol-2-ylamino)methyl]phenol.
What is the SMILES notation for 2-[(1,3-thiazol-2-ylamino)methyl]phenol?
The canonical SMILES for 2-[(1,3-thiazol-2-ylamino)methyl]phenol is Oc1ccccc1CNc1nccs1.
What is the InChIKey of 2-[(1,3-thiazol-2-ylamino)methyl]phenol?
The InChIKey is FUVLIIWCXQIRQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS/c13-9-4-2-1-3-8(9)7-12-10-11-5-6-14-10/h1-6,13H,7H2,(H,11,12).
What are the key properties of 2-[(1,3-thiazol-2-ylamino)methyl]phenol?
2-[(1,3-thiazol-2-ylamino)methyl]phenol has a molecular weight of 206.27 g/mol, XLogP of 2.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-thiazol-2-ylamino)methyl]phenol is sourced from PubChem (CID 853785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).