About [(2R)-butan-2-yl]urea
[(2R)-butan-2-yl]urea (PubChem CID 853797) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is [(2R)-butan-2-yl]urea.
Molecular Properties
| Compound Name | [(2R)-butan-2-yl]urea |
| PubChem CID | 853797 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | [(2R)-butan-2-yl]urea |
| SMILES | CC[C@@H](C)NC(N)=O |
| InChI | InChI=1S/C5H12N2O/c1-3-4(2)7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8)/t4-/m1/s1 |
| InChIKey | CBRSBDUOPJQVMP-SCSAIBSYSA-N |
| XLogP | 0.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(2R)-butan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-butan-2-yl]urea?
The IUPAC name of [(2R)-butan-2-yl]urea (CID 853797) is [(2R)-butan-2-yl]urea.
What is the SMILES notation for [(2R)-butan-2-yl]urea?
The canonical SMILES for [(2R)-butan-2-yl]urea is CC[C@@H](C)NC(N)=O.
What is the InChIKey of [(2R)-butan-2-yl]urea?
The InChIKey is CBRSBDUOPJQVMP-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-3-4(2)7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8)/t4-/m1/s1.
What are the key properties of [(2R)-butan-2-yl]urea?
[(2R)-butan-2-yl]urea has a molecular weight of 116.16 g/mol, XLogP of 0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-butan-2-yl]urea is sourced from PubChem (CID 853797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).