C12H20O3Si — CID 85381844
2,4-dimethyl-1-trimethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 85381844) has the molecular formula C12H20O3Si and a molecular weight of 240.37 g/mol. Its IUPAC name is 2,4-dimethyl-1-trimethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 2,4-dimethyl-1-trimethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 85381844 |
| Molecular Formula | C12H20O3Si |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2,4-dimethyl-1-trimethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC1C(=O)C(C)C2(O[Si](C)(C)C)C=CC1O2 |
| InChI | InChI=1S/C12H20O3Si/c1-8-10-6-7-12(14-10,9(2)11(8)13)15-16(3,4)5/h6-10H,1-5H3 |
| InChIKey | UTXKZKJTRQBBLA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|